C21H19N3O6 — CID 55316869
[2-(methylcarbamoylamino)-2-oxo-1-phenylethyl] 2-(1,3-dioxoisoindol-2-yl)propanoate (PubChem CID 55316869) has the molecular formula C21H19N3O6 and a molecular weight of 409.40 g/mol. Its IUPAC name is [2-(methylcarbamoylamino)-2-oxo-1-phenylethyl] 2-(1,3-dioxoisoindol-2-yl)propanoate.
| Compound Name | [2-(methylcarbamoylamino)-2-oxo-1-phenylethyl] 2-(1,3-dioxoisoindol-2-yl)propanoate |
|---|---|
| PubChem CID | 55316869 |
| Molecular Formula | C21H19N3O6 |
| Molecular Weight | 409.40 g/mol |
| Exact Mass | 409.13 |
| IUPAC Name | [2-(methylcarbamoylamino)-2-oxo-1-phenylethyl] 2-(1,3-dioxoisoindol-2-yl)propanoate |
| SMILES | CNC(=O)NC(=O)C(OC(=O)C(C)N1C(=O)c2ccccc2C1=O)c1ccccc1 |
| InChI | InChI=1S/C21H19N3O6/c1-12(24-18(26)14-10-6-7-11-15(14)19(24)27)20(28)30-16(13-8-4-3-5-9-13)17(25)23-21(29)22-2/h3-12,16H,1-2H3,(H2,22,23,25,29) |
| InChIKey | JJBWXTWTGAAMKR-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 121.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.40 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|