C20H16BrNOS — CID 2268280
(2R)-N-(3-bromophenyl)-2-phenyl-2-phenylsulfanylacetamide (PubChem CID 2268280) has the molecular formula C20H16BrNOS and a molecular weight of 398.33 g/mol. Its IUPAC name is (2R)-N-(3-bromophenyl)-2-phenyl-2-phenylsulfanylacetamide.
| Compound Name | (2R)-N-(3-bromophenyl)-2-phenyl-2-phenylsulfanylacetamide |
|---|---|
| PubChem CID | 2268280 |
| Molecular Formula | C20H16BrNOS |
| Molecular Weight | 398.33 g/mol |
| Exact Mass | 397.01 |
| IUPAC Name | (2R)-N-(3-bromophenyl)-2-phenyl-2-phenylsulfanylacetamide |
| SMILES | O=C(Nc1cccc(Br)c1)[C@H](Sc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C20H16BrNOS/c21-16-10-7-11-17(14-16)22-20(23)19(15-8-3-1-4-9-15)24-18-12-5-2-6-13-18/h1-14,19H,(H,22,23)/t19-/m1/s1 |
| InChIKey | KLYBOTSYYBSPLG-LJQANCHMSA-N |
| XLogP | 5.92 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.33 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |