C27H20N2O3 — CID 16814293
3-[(2-naphthalen-1-ylacetyl)amino]-N-phenyl-1-benzofuran-2-carboxamide (PubChem CID 16814293) has the molecular formula C27H20N2O3 and a molecular weight of 420.47 g/mol. Its IUPAC name is 3-[(2-naphthalen-1-ylacetyl)amino]-N-phenyl-1-benzofuran-2-carboxamide.
| Compound Name | 3-[(2-naphthalen-1-ylacetyl)amino]-N-phenyl-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 16814293 |
| Molecular Formula | C27H20N2O3 |
| Molecular Weight | 420.47 g/mol |
| Exact Mass | 420.15 |
| IUPAC Name | 3-[(2-naphthalen-1-ylacetyl)amino]-N-phenyl-1-benzofuran-2-carboxamide |
| SMILES | O=C(Cc1cccc2ccccc12)Nc1c(C(=O)Nc2ccccc2)oc2ccccc12 |
| InChI | InChI=1S/C27H20N2O3/c30-24(17-19-11-8-10-18-9-4-5-14-21(18)19)29-25-22-15-6-7-16-23(22)32-26(25)27(31)28-20-12-2-1-3-13-20/h1-16H,17H2,(H,28,31)(H,29,30) |
| InChIKey | XNQRAUXLTWODLQ-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 71.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.47 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |