C26H20N2O4 — CID 18861686
3-[[2-(6-methyl-1-benzofuran-3-yl)acetyl]amino]-N-phenyl-1-benzofuran-2-carboxamide (PubChem CID 18861686) has the molecular formula C26H20N2O4 and a molecular weight of 424.46 g/mol. Its IUPAC name is 3-[[2-(6-methyl-1-benzofuran-3-yl)acetyl]amino]-N-phenyl-1-benzofuran-2-carboxamide.
| Compound Name | 3-[[2-(6-methyl-1-benzofuran-3-yl)acetyl]amino]-N-phenyl-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 18861686 |
| Molecular Formula | C26H20N2O4 |
| Molecular Weight | 424.46 g/mol |
| Exact Mass | 424.14 |
| IUPAC Name | 3-[[2-(6-methyl-1-benzofuran-3-yl)acetyl]amino]-N-phenyl-1-benzofuran-2-carboxamide |
| SMILES | Cc1ccc2c(CC(=O)Nc3c(C(=O)Nc4ccccc4)oc4ccccc34)coc2c1 |
| InChI | InChI=1S/C26H20N2O4/c1-16-11-12-19-17(15-31-22(19)13-16)14-23(29)28-24-20-9-5-6-10-21(20)32-25(24)26(30)27-18-7-3-2-4-8-18/h2-13,15H,14H2,1H3,(H,27,30)(H,28,29) |
| InChIKey | YLCCOBBAEZVUDW-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 84.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.46 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |