C29H22N2O3 — CID 16814295
N-phenyl-3-[[2-(4-phenylphenyl)acetyl]amino]-1-benzofuran-2-carboxamide (PubChem CID 16814295) has the molecular formula C29H22N2O3 and a molecular weight of 446.51 g/mol. Its IUPAC name is N-phenyl-3-[[2-(4-phenylphenyl)acetyl]amino]-1-benzofuran-2-carboxamide.
| Compound Name | N-phenyl-3-[[2-(4-phenylphenyl)acetyl]amino]-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 16814295 |
| Molecular Formula | C29H22N2O3 |
| Molecular Weight | 446.51 g/mol |
| Exact Mass | 446.16 |
| IUPAC Name | N-phenyl-3-[[2-(4-phenylphenyl)acetyl]amino]-1-benzofuran-2-carboxamide |
| SMILES | O=C(Cc1ccc(-c2ccccc2)cc1)Nc1c(C(=O)Nc2ccccc2)oc2ccccc12 |
| InChI | InChI=1S/C29H22N2O3/c32-26(19-20-15-17-22(18-16-20)21-9-3-1-4-10-21)31-27-24-13-7-8-14-25(24)34-28(27)29(33)30-23-11-5-2-6-12-23/h1-18H,19H2,(H,30,33)(H,31,32) |
| InChIKey | HISODHXFIPEECA-UHFFFAOYSA-N |
| XLogP | 6.53 |
| TPSA | 71.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.51 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |