C23H17Cl2NO3 — CID 110826567
(3-chloro-4-methoxyphenyl)-[3-[(2-chlorophenyl)methylamino]-1-benzofuran-2-yl]methanone (PubChem CID 110826567) has the molecular formula C23H17Cl2NO3 and a molecular weight of 426.30 g/mol. Its IUPAC name is (3-chloro-4-methoxyphenyl)-[3-[(2-chlorophenyl)methylamino]-1-benzofuran-2-yl]methanone.
| Compound Name | (3-chloro-4-methoxyphenyl)-[3-[(2-chlorophenyl)methylamino]-1-benzofuran-2-yl]methanone |
|---|---|
| PubChem CID | 110826567 |
| Molecular Formula | C23H17Cl2NO3 |
| Molecular Weight | 426.30 g/mol |
| Exact Mass | 425.06 |
| IUPAC Name | (3-chloro-4-methoxyphenyl)-[3-[(2-chlorophenyl)methylamino]-1-benzofuran-2-yl]methanone |
| SMILES | COc1ccc(C(=O)c2oc3ccccc3c2NCc2ccccc2Cl)cc1Cl |
| InChI | InChI=1S/C23H17Cl2NO3/c1-28-20-11-10-14(12-18(20)25)22(27)23-21(16-7-3-5-9-19(16)29-23)26-13-15-6-2-4-8-17(15)24/h2-12,26H,13H2,1H3 |
| InChIKey | IOAHEQQAMQXBLI-UHFFFAOYSA-N |
| XLogP | 6.59 |
| TPSA | 51.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.30 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |