C25H23BrN2O3 — CID 92500941
N-[2-[(R)-(4-bromophenyl)-piperidin-1-ylmethyl]-1-benzofuran-3-yl]furan-2-carboxamide (PubChem CID 92500941) has the molecular formula C25H23BrN2O3 and a molecular weight of 479.37 g/mol. Its IUPAC name is N-[2-[(R)-(4-bromophenyl)-piperidin-1-ylmethyl]-1-benzofuran-3-yl]furan-2-carboxamide.
| Compound Name | N-[2-[(R)-(4-bromophenyl)-piperidin-1-ylmethyl]-1-benzofuran-3-yl]furan-2-carboxamide |
|---|---|
| PubChem CID | 92500941 |
| Molecular Formula | C25H23BrN2O3 |
| Molecular Weight | 479.37 g/mol |
| Exact Mass | 478.09 |
| IUPAC Name | N-[2-[(R)-(4-bromophenyl)-piperidin-1-ylmethyl]-1-benzofuran-3-yl]furan-2-carboxamide |
| SMILES | O=C(Nc1c([C@@H](c2ccc(Br)cc2)N2CCCCC2)oc2ccccc12)c1ccco1 |
| InChI | InChI=1S/C25H23BrN2O3/c26-18-12-10-17(11-13-18)23(28-14-4-1-5-15-28)24-22(19-7-2-3-8-20(19)31-24)27-25(29)21-9-6-16-30-21/h2-3,6-13,16,23H,1,4-5,14-15H2,(H,27,29)/t23-/m1/s1 |
| InChIKey | YGOUBXDQHIPAJP-HSZRJFAPSA-N |
| XLogP | 6.62 |
| TPSA | 58.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.37 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |