C24H21ClN2O4 — CID 46269989
N-[2-[(4-chlorophenyl)-morpholin-4-ylmethyl]-1-benzofuran-3-yl]furan-2-carboxamide (PubChem CID 46269989) has the molecular formula C24H21ClN2O4 and a molecular weight of 436.90 g/mol. Its IUPAC name is N-[2-[(4-chlorophenyl)-morpholin-4-ylmethyl]-1-benzofuran-3-yl]furan-2-carboxamide.
| Compound Name | N-[2-[(4-chlorophenyl)-morpholin-4-ylmethyl]-1-benzofuran-3-yl]furan-2-carboxamide |
|---|---|
| PubChem CID | 46269989 |
| Molecular Formula | C24H21ClN2O4 |
| Molecular Weight | 436.90 g/mol |
| Exact Mass | 436.12 |
| IUPAC Name | N-[2-[(4-chlorophenyl)-morpholin-4-ylmethyl]-1-benzofuran-3-yl]furan-2-carboxamide |
| SMILES | O=C(Nc1c(C(c2ccc(Cl)cc2)N2CCOCC2)oc2ccccc12)c1ccco1 |
| InChI | InChI=1S/C24H21ClN2O4/c25-17-9-7-16(8-10-17)22(27-11-14-29-15-12-27)23-21(18-4-1-2-5-19(18)31-23)26-24(28)20-6-3-13-30-20/h1-10,13,22H,11-12,14-15H2,(H,26,28) |
| InChIKey | NTFLEWZBTPBLFN-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 67.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.90 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |