C26H23ClN2O3 — CID 92501068
N-[2-[(S)-(3-chlorophenyl)-morpholin-4-ylmethyl]-1-benzofuran-3-yl]benzamide (PubChem CID 92501068) has the molecular formula C26H23ClN2O3 and a molecular weight of 446.93 g/mol. Its IUPAC name is N-[2-[(S)-(3-chlorophenyl)-morpholin-4-ylmethyl]-1-benzofuran-3-yl]benzamide.
| Compound Name | N-[2-[(S)-(3-chlorophenyl)-morpholin-4-ylmethyl]-1-benzofuran-3-yl]benzamide |
|---|---|
| PubChem CID | 92501068 |
| Molecular Formula | C26H23ClN2O3 |
| Molecular Weight | 446.93 g/mol |
| Exact Mass | 446.14 |
| IUPAC Name | N-[2-[(S)-(3-chlorophenyl)-morpholin-4-ylmethyl]-1-benzofuran-3-yl]benzamide |
| SMILES | O=C(Nc1c([C@H](c2cccc(Cl)c2)N2CCOCC2)oc2ccccc12)c1ccccc1 |
| InChI | InChI=1S/C26H23ClN2O3/c27-20-10-6-9-19(17-20)24(29-13-15-31-16-14-29)25-23(21-11-4-5-12-22(21)32-25)28-26(30)18-7-2-1-3-8-18/h1-12,17,24H,13-16H2,(H,28,30)/t24-/m0/s1 |
| InChIKey | BSWZKSCGDBFABO-DEOSSOPVSA-N |
| XLogP | 5.76 |
| TPSA | 54.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.93 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |