C28H27ClN2O2 — CID 20899146
N-[2-[(4-chlorophenyl)-(4-methylpiperidin-1-yl)methyl]-1-benzofuran-3-yl]benzamide (PubChem CID 20899146) has the molecular formula C28H27ClN2O2 and a molecular weight of 458.99 g/mol. Its IUPAC name is N-[2-[(4-chlorophenyl)-(4-methylpiperidin-1-yl)methyl]-1-benzofuran-3-yl]benzamide.
| Compound Name | N-[2-[(4-chlorophenyl)-(4-methylpiperidin-1-yl)methyl]-1-benzofuran-3-yl]benzamide |
|---|---|
| PubChem CID | 20899146 |
| Molecular Formula | C28H27ClN2O2 |
| Molecular Weight | 458.99 g/mol |
| Exact Mass | 458.18 |
| IUPAC Name | N-[2-[(4-chlorophenyl)-(4-methylpiperidin-1-yl)methyl]-1-benzofuran-3-yl]benzamide |
| SMILES | CC1CCN(C(c2ccc(Cl)cc2)c2oc3ccccc3c2NC(=O)c2ccccc2)CC1 |
| InChI | InChI=1S/C28H27ClN2O2/c1-19-15-17-31(18-16-19)26(20-11-13-22(29)14-12-20)27-25(23-9-5-6-10-24(23)33-27)30-28(32)21-7-3-2-4-8-21/h2-14,19,26H,15-18H2,1H3,(H,30,32) |
| InChIKey | WCNPRQUNIRLLEJ-UHFFFAOYSA-N |
| XLogP | 7.16 |
| TPSA | 45.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.99 |
| LogP ≤ 5 | 7.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |