C28H27FN2O2 — CID 46270057
N-[2-[(3-fluorophenyl)-(4-methylpiperidin-1-yl)methyl]-1-benzofuran-3-yl]benzamide (PubChem CID 46270057) has the molecular formula C28H27FN2O2 and a molecular weight of 442.53 g/mol. Its IUPAC name is N-[2-[(3-fluorophenyl)-(4-methylpiperidin-1-yl)methyl]-1-benzofuran-3-yl]benzamide.
| Compound Name | N-[2-[(3-fluorophenyl)-(4-methylpiperidin-1-yl)methyl]-1-benzofuran-3-yl]benzamide |
|---|---|
| PubChem CID | 46270057 |
| Molecular Formula | C28H27FN2O2 |
| Molecular Weight | 442.53 g/mol |
| Exact Mass | 442.21 |
| IUPAC Name | N-[2-[(3-fluorophenyl)-(4-methylpiperidin-1-yl)methyl]-1-benzofuran-3-yl]benzamide |
| SMILES | CC1CCN(C(c2cccc(F)c2)c2oc3ccccc3c2NC(=O)c2ccccc2)CC1 |
| InChI | InChI=1S/C28H27FN2O2/c1-19-14-16-31(17-15-19)26(21-10-7-11-22(29)18-21)27-25(23-12-5-6-13-24(23)33-27)30-28(32)20-8-3-2-4-9-20/h2-13,18-19,26H,14-17H2,1H3,(H,30,32) |
| InChIKey | FUJHBMODLPMDIT-UHFFFAOYSA-N |
| XLogP | 6.65 |
| TPSA | 45.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.53 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |