C24H21BrN2O3S — CID 46270044
N-[2-[(4-bromophenyl)-morpholin-4-ylmethyl]-1-benzofuran-3-yl]thiophene-2-carboxamide (PubChem CID 46270044) has the molecular formula C24H21BrN2O3S and a molecular weight of 497.41 g/mol. Its IUPAC name is N-[2-[(4-bromophenyl)-morpholin-4-ylmethyl]-1-benzofuran-3-yl]thiophene-2-carboxamide.
| Compound Name | N-[2-[(4-bromophenyl)-morpholin-4-ylmethyl]-1-benzofuran-3-yl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 46270044 |
| Molecular Formula | C24H21BrN2O3S |
| Molecular Weight | 497.41 g/mol |
| Exact Mass | 496.05 |
| IUPAC Name | N-[2-[(4-bromophenyl)-morpholin-4-ylmethyl]-1-benzofuran-3-yl]thiophene-2-carboxamide |
| SMILES | O=C(Nc1c(C(c2ccc(Br)cc2)N2CCOCC2)oc2ccccc12)c1cccs1 |
| InChI | InChI=1S/C24H21BrN2O3S/c25-17-9-7-16(8-10-17)22(27-11-13-29-14-12-27)23-21(18-4-1-2-5-19(18)30-23)26-24(28)20-6-3-15-31-20/h1-10,15,22H,11-14H2,(H,26,28) |
| InChIKey | QAGCUFKMXILZIV-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 54.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.41 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |