C29H30N2O2S — CID 46270087
4-methyl-N-[2-[(4-methylsulfanylphenyl)-piperidin-1-ylmethyl]-1-benzofuran-3-yl]benzamide (PubChem CID 46270087) has the molecular formula C29H30N2O2S and a molecular weight of 470.64 g/mol. Its IUPAC name is 4-methyl-N-[2-[(4-methylsulfanylphenyl)-piperidin-1-ylmethyl]-1-benzofuran-3-yl]benzamide.
| Compound Name | 4-methyl-N-[2-[(4-methylsulfanylphenyl)-piperidin-1-ylmethyl]-1-benzofuran-3-yl]benzamide |
|---|---|
| PubChem CID | 46270087 |
| Molecular Formula | C29H30N2O2S |
| Molecular Weight | 470.64 g/mol |
| Exact Mass | 470.20 |
| IUPAC Name | 4-methyl-N-[2-[(4-methylsulfanylphenyl)-piperidin-1-ylmethyl]-1-benzofuran-3-yl]benzamide |
| SMILES | CSc1ccc(C(c2oc3ccccc3c2NC(=O)c2ccc(C)cc2)N2CCCCC2)cc1 |
| InChI | InChI=1S/C29H30N2O2S/c1-20-10-12-22(13-11-20)29(32)30-26-24-8-4-5-9-25(24)33-28(26)27(31-18-6-3-7-19-31)21-14-16-23(34-2)17-15-21/h4-5,8-17,27H,3,6-7,18-19H2,1-2H3,(H,30,32) |
| InChIKey | ATFDVIYFALDJMO-UHFFFAOYSA-N |
| XLogP | 7.29 |
| TPSA | 45.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.64 |
| LogP ≤ 5 | 7.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |