C17H13NO4 — CID 110703196
N-(1,3-benzodioxol-5-yl)-2-methyl-1-benzofuran-3-carboxamide (PubChem CID 110703196) has the molecular formula C17H13NO4 and a molecular weight of 295.29 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-yl)-2-methyl-1-benzofuran-3-carboxamide.
| Compound Name | N-(1,3-benzodioxol-5-yl)-2-methyl-1-benzofuran-3-carboxamide |
|---|---|
| PubChem CID | 110703196 |
| Molecular Formula | C17H13NO4 |
| Molecular Weight | 295.29 g/mol |
| Exact Mass | 295.08 |
| IUPAC Name | N-(1,3-benzodioxol-5-yl)-2-methyl-1-benzofuran-3-carboxamide |
| SMILES | Cc1oc2ccccc2c1C(=O)Nc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C17H13NO4/c1-10-16(12-4-2-3-5-13(12)22-10)17(19)18-11-6-7-14-15(8-11)21-9-20-14/h2-8H,9H2,1H3,(H,18,19) |
| InChIKey | ZPYUPSJMNBXQHZ-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 60.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.29 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |