C15H20N2O5 — CID 121132594
N'-[3-(1,3-benzodioxol-5-yl)-3-hydroxypropyl]-N-propyloxamide (PubChem CID 121132594) has the molecular formula C15H20N2O5 and a molecular weight of 308.33 g/mol. Its IUPAC name is N'-[3-(1,3-benzodioxol-5-yl)-3-hydroxypropyl]-N-propyloxamide.
| Compound Name | N'-[3-(1,3-benzodioxol-5-yl)-3-hydroxypropyl]-N-propyloxamide |
|---|---|
| PubChem CID | 121132594 |
| Molecular Formula | C15H20N2O5 |
| Molecular Weight | 308.33 g/mol |
| Exact Mass | 308.14 |
| IUPAC Name | N'-[3-(1,3-benzodioxol-5-yl)-3-hydroxypropyl]-N-propyloxamide |
| SMILES | CCCNC(=O)C(=O)NCCC(O)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C15H20N2O5/c1-2-6-16-14(19)15(20)17-7-5-11(18)10-3-4-12-13(8-10)22-9-21-12/h3-4,8,11,18H,2,5-7,9H2,1H3,(H,16,19)(H,17,20) |
| InChIKey | NKXJOMIXKYSURI-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 96.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.33 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|