C19H20N2O5S — CID 71804371
N-[3-(1,3-benzodioxol-5-yl)-3-hydroxypropyl]-N'-(2-methylsulfanylphenyl)oxamide (PubChem CID 71804371) has the molecular formula C19H20N2O5S and a molecular weight of 388.45 g/mol. Its IUPAC name is N-[3-(1,3-benzodioxol-5-yl)-3-hydroxypropyl]-N'-(2-methylsulfanylphenyl)oxamide.
| Compound Name | N-[3-(1,3-benzodioxol-5-yl)-3-hydroxypropyl]-N'-(2-methylsulfanylphenyl)oxamide |
|---|---|
| PubChem CID | 71804371 |
| Molecular Formula | C19H20N2O5S |
| Molecular Weight | 388.45 g/mol |
| Exact Mass | 388.11 |
| IUPAC Name | N-[3-(1,3-benzodioxol-5-yl)-3-hydroxypropyl]-N'-(2-methylsulfanylphenyl)oxamide |
| SMILES | CSc1ccccc1NC(=O)C(=O)NCCC(O)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C19H20N2O5S/c1-27-17-5-3-2-4-13(17)21-19(24)18(23)20-9-8-14(22)12-6-7-15-16(10-12)26-11-25-15/h2-7,10,14,22H,8-9,11H2,1H3,(H,20,23)(H,21,24) |
| InChIKey | LVUCKNXZUMAMGW-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 96.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.45 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|