C17H17FN2O4 — CID 121132677
1-[3-(1,3-benzodioxol-5-yl)-3-hydroxypropyl]-3-(4-fluorophenyl)urea (PubChem CID 121132677) has the molecular formula C17H17FN2O4 and a molecular weight of 332.33 g/mol. Its IUPAC name is 1-[3-(1,3-benzodioxol-5-yl)-3-hydroxypropyl]-3-(4-fluorophenyl)urea.
| Compound Name | 1-[3-(1,3-benzodioxol-5-yl)-3-hydroxypropyl]-3-(4-fluorophenyl)urea |
|---|---|
| PubChem CID | 121132677 |
| Molecular Formula | C17H17FN2O4 |
| Molecular Weight | 332.33 g/mol |
| Exact Mass | 332.12 |
| IUPAC Name | 1-[3-(1,3-benzodioxol-5-yl)-3-hydroxypropyl]-3-(4-fluorophenyl)urea |
| SMILES | O=C(NCCC(O)c1ccc2c(c1)OCO2)Nc1ccc(F)cc1 |
| InChI | InChI=1S/C17H17FN2O4/c18-12-2-4-13(5-3-12)20-17(22)19-8-7-14(21)11-1-6-15-16(9-11)24-10-23-15/h1-6,9,14,21H,7-8,10H2,(H2,19,20,22) |
| InChIKey | CXIMHCMBZUAJGP-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 79.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.33 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |