C21H26N2O4 — CID 121132692
1-[3-(1,3-benzodioxol-5-yl)-3-hydroxypropyl]-3-(4-tert-butylphenyl)urea (PubChem CID 121132692) has the molecular formula C21H26N2O4 and a molecular weight of 370.45 g/mol. Its IUPAC name is 1-[3-(1,3-benzodioxol-5-yl)-3-hydroxypropyl]-3-(4-tert-butylphenyl)urea.
| Compound Name | 1-[3-(1,3-benzodioxol-5-yl)-3-hydroxypropyl]-3-(4-tert-butylphenyl)urea |
|---|---|
| PubChem CID | 121132692 |
| Molecular Formula | C21H26N2O4 |
| Molecular Weight | 370.45 g/mol |
| Exact Mass | 370.19 |
| IUPAC Name | 1-[3-(1,3-benzodioxol-5-yl)-3-hydroxypropyl]-3-(4-tert-butylphenyl)urea |
| SMILES | CC(C)(C)c1ccc(NC(=O)NCCC(O)c2ccc3c(c2)OCO3)cc1 |
| InChI | InChI=1S/C21H26N2O4/c1-21(2,3)15-5-7-16(8-6-15)23-20(25)22-11-10-17(24)14-4-9-18-19(12-14)27-13-26-18/h4-9,12,17,24H,10-11,13H2,1-3H3,(H2,22,23,25) |
| InChIKey | GJZIPASLNMSRTM-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 79.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.45 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |