C19H20N2O8 — CID 121132489
N-[3-(1,3-benzodioxol-5-yl)-3-hydroxypropyl]-4,5-dimethoxy-2-nitrobenzamide (PubChem CID 121132489) has the molecular formula C19H20N2O8 and a molecular weight of 404.38 g/mol. Its IUPAC name is N-[3-(1,3-benzodioxol-5-yl)-3-hydroxypropyl]-4,5-dimethoxy-2-nitrobenzamide.
| Compound Name | N-[3-(1,3-benzodioxol-5-yl)-3-hydroxypropyl]-4,5-dimethoxy-2-nitrobenzamide |
|---|---|
| PubChem CID | 121132489 |
| Molecular Formula | C19H20N2O8 |
| Molecular Weight | 404.38 g/mol |
| Exact Mass | 404.12 |
| IUPAC Name | N-[3-(1,3-benzodioxol-5-yl)-3-hydroxypropyl]-4,5-dimethoxy-2-nitrobenzamide |
| SMILES | COc1cc(C(=O)NCCC(O)c2ccc3c(c2)OCO3)c([N+](=O)[O-])cc1OC |
| InChI | InChI=1S/C19H20N2O8/c1-26-16-8-12(13(21(24)25)9-17(16)27-2)19(23)20-6-5-14(22)11-3-4-15-18(7-11)29-10-28-15/h3-4,7-9,14,22H,5-6,10H2,1-2H3,(H,20,23) |
| InChIKey | PHZJPOKJLXGPKL-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 129.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.38 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|