C19H20N2O8 — CID 18143591
N-[1-(1,3-benzodioxol-5-yl)ethyl]-3,4,5-trimethoxy-2-nitrobenzamide (PubChem CID 18143591) has the molecular formula C19H20N2O8 and a molecular weight of 404.38 g/mol. Its IUPAC name is N-[1-(1,3-benzodioxol-5-yl)ethyl]-3,4,5-trimethoxy-2-nitrobenzamide.
| Compound Name | N-[1-(1,3-benzodioxol-5-yl)ethyl]-3,4,5-trimethoxy-2-nitrobenzamide |
|---|---|
| PubChem CID | 18143591 |
| Molecular Formula | C19H20N2O8 |
| Molecular Weight | 404.38 g/mol |
| Exact Mass | 404.12 |
| IUPAC Name | N-[1-(1,3-benzodioxol-5-yl)ethyl]-3,4,5-trimethoxy-2-nitrobenzamide |
| SMILES | COc1cc(C(=O)NC(C)c2ccc3c(c2)OCO3)c([N+](=O)[O-])c(OC)c1OC |
| InChI | InChI=1S/C19H20N2O8/c1-10(11-5-6-13-14(7-11)29-9-28-13)20-19(22)12-8-15(25-2)17(26-3)18(27-4)16(12)21(23)24/h5-8,10H,9H2,1-4H3,(H,20,22) |
| InChIKey | CSJXLSJBUHFOSZ-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 118.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.38 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|