C24H23N3O7 — CID 55779332
N-(2-anilino-2-oxo-1-phenylethyl)-3,4,5-trimethoxy-2-nitrobenzamide (PubChem CID 55779332) has the molecular formula C24H23N3O7 and a molecular weight of 465.46 g/mol. Its IUPAC name is N-(2-anilino-2-oxo-1-phenylethyl)-3,4,5-trimethoxy-2-nitrobenzamide.
| Compound Name | N-(2-anilino-2-oxo-1-phenylethyl)-3,4,5-trimethoxy-2-nitrobenzamide |
|---|---|
| PubChem CID | 55779332 |
| Molecular Formula | C24H23N3O7 |
| Molecular Weight | 465.46 g/mol |
| Exact Mass | 465.15 |
| IUPAC Name | N-(2-anilino-2-oxo-1-phenylethyl)-3,4,5-trimethoxy-2-nitrobenzamide |
| SMILES | COc1cc(C(=O)NC(C(=O)Nc2ccccc2)c2ccccc2)c([N+](=O)[O-])c(OC)c1OC |
| InChI | InChI=1S/C24H23N3O7/c1-32-18-14-17(20(27(30)31)22(34-3)21(18)33-2)23(28)26-19(15-10-6-4-7-11-15)24(29)25-16-12-8-5-9-13-16/h4-14,19H,1-3H3,(H,25,29)(H,26,28) |
| InChIKey | ZBPVOSJHSHGHPG-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 129.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.46 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|