C20H20N4O7 — CID 56552794
3,4,5-trimethoxy-N-[5-(2-methoxyphenyl)-1H-pyrazol-3-yl]-2-nitrobenzamide (PubChem CID 56552794) has the molecular formula C20H20N4O7 and a molecular weight of 428.40 g/mol. Its IUPAC name is 3,4,5-trimethoxy-N-[5-(2-methoxyphenyl)-1H-pyrazol-3-yl]-2-nitrobenzamide.
| Compound Name | 3,4,5-trimethoxy-N-[5-(2-methoxyphenyl)-1H-pyrazol-3-yl]-2-nitrobenzamide |
|---|---|
| PubChem CID | 56552794 |
| Molecular Formula | C20H20N4O7 |
| Molecular Weight | 428.40 g/mol |
| Exact Mass | 428.13 |
| IUPAC Name | 3,4,5-trimethoxy-N-[5-(2-methoxyphenyl)-1H-pyrazol-3-yl]-2-nitrobenzamide |
| SMILES | COc1ccccc1-c1cc(NC(=O)c2cc(OC)c(OC)c(OC)c2[N+](=O)[O-])n[nH]1 |
| InChI | InChI=1S/C20H20N4O7/c1-28-14-8-6-5-7-11(14)13-10-16(23-22-13)21-20(25)12-9-15(29-2)18(30-3)19(31-4)17(12)24(26)27/h5-10H,1-4H3,(H2,21,22,23,25) |
| InChIKey | DJUJZNDBCAIGMS-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 137.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.40 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|