C22H18N4O3S — CID 56552544
N-[2-[[5-(2-methoxyphenyl)-1H-pyrazol-3-yl]carbamoyl]phenyl]thiophene-2-carboxamide (PubChem CID 56552544) has the molecular formula C22H18N4O3S and a molecular weight of 418.48 g/mol. Its IUPAC name is N-[2-[[5-(2-methoxyphenyl)-1H-pyrazol-3-yl]carbamoyl]phenyl]thiophene-2-carboxamide.
| Compound Name | N-[2-[[5-(2-methoxyphenyl)-1H-pyrazol-3-yl]carbamoyl]phenyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 56552544 |
| Molecular Formula | C22H18N4O3S |
| Molecular Weight | 418.48 g/mol |
| Exact Mass | 418.11 |
| IUPAC Name | N-[2-[[5-(2-methoxyphenyl)-1H-pyrazol-3-yl]carbamoyl]phenyl]thiophene-2-carboxamide |
| SMILES | COc1ccccc1-c1cc(NC(=O)c2ccccc2NC(=O)c2cccs2)n[nH]1 |
| InChI | InChI=1S/C22H18N4O3S/c1-29-18-10-5-3-7-14(18)17-13-20(26-25-17)24-21(27)15-8-2-4-9-16(15)23-22(28)19-11-6-12-30-19/h2-13H,1H3,(H,23,28)(H2,24,25,26,27) |
| InChIKey | PGXJFQPNDFZOKM-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 96.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.48 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |