C17H15NO4 — CID 20854774
2-(4-ethoxyphenyl)-3-oxo-1H-isoindole-5-carboxylic acid (PubChem CID 20854774) has the molecular formula C17H15NO4 and a molecular weight of 297.31 g/mol. Its IUPAC name is 2-(4-ethoxyphenyl)-3-oxo-1H-isoindole-5-carboxylic acid.
| Compound Name | 2-(4-ethoxyphenyl)-3-oxo-1H-isoindole-5-carboxylic acid |
|---|---|
| PubChem CID | 20854774 |
| Molecular Formula | C17H15NO4 |
| Molecular Weight | 297.31 g/mol |
| Exact Mass | 297.10 |
| IUPAC Name | 2-(4-ethoxyphenyl)-3-oxo-1H-isoindole-5-carboxylic acid |
| SMILES | CCOc1ccc(N2Cc3ccc(C(=O)O)cc3C2=O)cc1 |
| InChI | InChI=1S/C17H15NO4/c1-2-22-14-7-5-13(6-8-14)18-10-12-4-3-11(17(20)21)9-15(12)16(18)19/h3-9H,2,10H2,1H3,(H,20,21) |
| InChIKey | HBAUFRUMYZOKNN-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.31 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |