C25H17Cl2NO5 — CID 2283483
[(2S)-1-(4-methylphenyl)-1-oxopropan-2-yl] 2-(2,4-dichlorophenyl)-1,3-dioxoisoindole-5-carboxylate (PubChem CID 2283483) has the molecular formula C25H17Cl2NO5 and a molecular weight of 482.32 g/mol. Its IUPAC name is [(2S)-1-(4-methylphenyl)-1-oxopropan-2-yl] 2-(2,4-dichlorophenyl)-1,3-dioxoisoindole-5-carboxylate.
| Compound Name | [(2S)-1-(4-methylphenyl)-1-oxopropan-2-yl] 2-(2,4-dichlorophenyl)-1,3-dioxoisoindole-5-carboxylate |
|---|---|
| PubChem CID | 2283483 |
| Molecular Formula | C25H17Cl2NO5 |
| Molecular Weight | 482.32 g/mol |
| Exact Mass | 481.05 |
| IUPAC Name | [(2S)-1-(4-methylphenyl)-1-oxopropan-2-yl] 2-(2,4-dichlorophenyl)-1,3-dioxoisoindole-5-carboxylate |
| SMILES | Cc1ccc(C(=O)[C@H](C)OC(=O)c2ccc3c(c2)C(=O)N(c2ccc(Cl)cc2Cl)C3=O)cc1 |
| InChI | InChI=1S/C25H17Cl2NO5/c1-13-3-5-15(6-4-13)22(29)14(2)33-25(32)16-7-9-18-19(11-16)24(31)28(23(18)30)21-10-8-17(26)12-20(21)27/h3-12,14H,1-2H3/t14-/m0/s1 |
| InChIKey | MBRWINSTSVQJLB-AWEZNQCLSA-N |
| XLogP | 5.53 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.32 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|