C26H20F2N2O5 — CID 55419760
[1-(2,5-difluoroanilino)-1-oxopropan-2-yl] 2-(2,5-dimethylphenyl)-1,3-dioxoisoindole-5-carboxylate (PubChem CID 55419760) has the molecular formula C26H20F2N2O5 and a molecular weight of 478.45 g/mol. Its IUPAC name is [1-(2,5-difluoroanilino)-1-oxopropan-2-yl] 2-(2,5-dimethylphenyl)-1,3-dioxoisoindole-5-carboxylate.
| Compound Name | [1-(2,5-difluoroanilino)-1-oxopropan-2-yl] 2-(2,5-dimethylphenyl)-1,3-dioxoisoindole-5-carboxylate |
|---|---|
| PubChem CID | 55419760 |
| Molecular Formula | C26H20F2N2O5 |
| Molecular Weight | 478.45 g/mol |
| Exact Mass | 478.13 |
| IUPAC Name | [1-(2,5-difluoroanilino)-1-oxopropan-2-yl] 2-(2,5-dimethylphenyl)-1,3-dioxoisoindole-5-carboxylate |
| SMILES | Cc1ccc(C)c(N2C(=O)c3ccc(C(=O)OC(C)C(=O)Nc4cc(F)ccc4F)cc3C2=O)c1 |
| InChI | InChI=1S/C26H20F2N2O5/c1-13-4-5-14(2)22(10-13)30-24(32)18-8-6-16(11-19(18)25(30)33)26(34)35-15(3)23(31)29-21-12-17(27)7-9-20(21)28/h4-12,15H,1-3H3,(H,29,31) |
| InChIKey | QGQSTEYDLVFYDF-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.45 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|