C24H26N2O5 — CID 3337021
[1-(2,4-dimethylanilino)-1-oxopropan-2-yl] 2-butan-2-yl-1,3-dioxoisoindole-5-carboxylate (PubChem CID 3337021) has the molecular formula C24H26N2O5 and a molecular weight of 422.48 g/mol. Its IUPAC name is [1-(2,4-dimethylanilino)-1-oxopropan-2-yl] 2-butan-2-yl-1,3-dioxoisoindole-5-carboxylate.
| Compound Name | [1-(2,4-dimethylanilino)-1-oxopropan-2-yl] 2-butan-2-yl-1,3-dioxoisoindole-5-carboxylate |
|---|---|
| PubChem CID | 3337021 |
| Molecular Formula | C24H26N2O5 |
| Molecular Weight | 422.48 g/mol |
| Exact Mass | 422.18 |
| IUPAC Name | [1-(2,4-dimethylanilino)-1-oxopropan-2-yl] 2-butan-2-yl-1,3-dioxoisoindole-5-carboxylate |
| SMILES | CCC(C)N1C(=O)c2ccc(C(=O)OC(C)C(=O)Nc3ccc(C)cc3C)cc2C1=O |
| InChI | InChI=1S/C24H26N2O5/c1-6-15(4)26-22(28)18-9-8-17(12-19(18)23(26)29)24(30)31-16(5)21(27)25-20-10-7-13(2)11-14(20)3/h7-12,15-16H,6H2,1-5H3,(H,25,27) |
| InChIKey | NXWSSGUQXZPNRT-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.48 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|