C24H25N3O6 — CID 27362381
[(2S)-1-oxo-1-(propan-2-ylcarbamoylamino)propan-2-yl] 2-(2,5-dimethylphenyl)-1,3-dioxoisoindole-5-carboxylate (PubChem CID 27362381) has the molecular formula C24H25N3O6 and a molecular weight of 451.48 g/mol. Its IUPAC name is [(2S)-1-oxo-1-(propan-2-ylcarbamoylamino)propan-2-yl] 2-(2,5-dimethylphenyl)-1,3-dioxoisoindole-5-carboxylate.
| Compound Name | [(2S)-1-oxo-1-(propan-2-ylcarbamoylamino)propan-2-yl] 2-(2,5-dimethylphenyl)-1,3-dioxoisoindole-5-carboxylate |
|---|---|
| PubChem CID | 27362381 |
| Molecular Formula | C24H25N3O6 |
| Molecular Weight | 451.48 g/mol |
| Exact Mass | 451.17 |
| IUPAC Name | [(2S)-1-oxo-1-(propan-2-ylcarbamoylamino)propan-2-yl] 2-(2,5-dimethylphenyl)-1,3-dioxoisoindole-5-carboxylate |
| SMILES | Cc1ccc(C)c(N2C(=O)c3ccc(C(=O)O[C@@H](C)C(=O)NC(=O)NC(C)C)cc3C2=O)c1 |
| InChI | InChI=1S/C24H25N3O6/c1-12(2)25-24(32)26-20(28)15(5)33-23(31)16-8-9-17-18(11-16)22(30)27(21(17)29)19-10-13(3)6-7-14(19)4/h6-12,15H,1-5H3,(H2,25,26,28,32)/t15-/m0/s1 |
| InChIKey | MVQZBYSZOYYYGX-HNNXBMFYSA-N |
| XLogP | 2.88 |
| TPSA | 121.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.48 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|