C37H26ClNO7 — CID 40736187
[(2S)-1-oxo-1-(4-phenylmethoxyphenyl)propan-2-yl] 2-[4-(2-chlorophenoxy)phenyl]-1,3-dioxoisoindole-5-carboxylate (PubChem CID 40736187) has the molecular formula C37H26ClNO7 and a molecular weight of 632.07 g/mol. Its IUPAC name is [(2S)-1-oxo-1-(4-phenylmethoxyphenyl)propan-2-yl] 2-[4-(2-chlorophenoxy)phenyl]-1,3-dioxoisoindole-5-carboxylate.
| Compound Name | [(2S)-1-oxo-1-(4-phenylmethoxyphenyl)propan-2-yl] 2-[4-(2-chlorophenoxy)phenyl]-1,3-dioxoisoindole-5-carboxylate |
|---|---|
| PubChem CID | 40736187 |
| Molecular Formula | C37H26ClNO7 |
| Molecular Weight | 632.07 g/mol |
| Exact Mass | 631.14 |
| IUPAC Name | [(2S)-1-oxo-1-(4-phenylmethoxyphenyl)propan-2-yl] 2-[4-(2-chlorophenoxy)phenyl]-1,3-dioxoisoindole-5-carboxylate |
| SMILES | C[C@H](OC(=O)c1ccc2c(c1)C(=O)N(c1ccc(Oc3ccccc3Cl)cc1)C2=O)C(=O)c1ccc(OCc2ccccc2)cc1 |
| InChI | InChI=1S/C37H26ClNO7/c1-23(34(40)25-11-16-28(17-12-25)44-22-24-7-3-2-4-8-24)45-37(43)26-13-20-30-31(21-26)36(42)39(35(30)41)27-14-18-29(19-15-27)46-33-10-6-5-9-32(33)38/h2-21,23H,22H2,1H3/t23-/m0/s1 |
| InChIKey | KVPACUWBVAUGHU-QHCPKHFHSA-N |
| XLogP | 7.94 |
| TPSA | 99.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.07 |
| LogP ≤ 5 | 7.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|