C21H15N3O5S — CID 124578877
[(2S)-1-oxo-1-phenylpropan-2-yl] 2-(5-methyl-1,3,4-thiadiazol-2-yl)-1,3-dioxoisoindole-5-carboxylate (PubChem CID 124578877) has the molecular formula C21H15N3O5S and a molecular weight of 421.43 g/mol. Its IUPAC name is [(2S)-1-oxo-1-phenylpropan-2-yl] 2-(5-methyl-1,3,4-thiadiazol-2-yl)-1,3-dioxoisoindole-5-carboxylate.
| Compound Name | [(2S)-1-oxo-1-phenylpropan-2-yl] 2-(5-methyl-1,3,4-thiadiazol-2-yl)-1,3-dioxoisoindole-5-carboxylate |
|---|---|
| PubChem CID | 124578877 |
| Molecular Formula | C21H15N3O5S |
| Molecular Weight | 421.43 g/mol |
| Exact Mass | 421.07 |
| IUPAC Name | [(2S)-1-oxo-1-phenylpropan-2-yl] 2-(5-methyl-1,3,4-thiadiazol-2-yl)-1,3-dioxoisoindole-5-carboxylate |
| SMILES | Cc1nnc(N2C(=O)c3ccc(C(=O)O[C@@H](C)C(=O)c4ccccc4)cc3C2=O)s1 |
| InChI | InChI=1S/C21H15N3O5S/c1-11(17(25)13-6-4-3-5-7-13)29-20(28)14-8-9-15-16(10-14)19(27)24(18(15)26)21-23-22-12(2)30-21/h3-11H,1-2H3/t11-/m0/s1 |
| InChIKey | LIPDYUZBWDGSCF-NSHDSACASA-N |
| XLogP | 3.08 |
| TPSA | 106.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.43 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|