C22H15ClFN3O5S — CID 124580361
[(2S)-4-chloro-1-(4-fluorophenyl)-1-oxobutan-2-yl] 2-(5-methyl-1,3,4-thiadiazol-2-yl)-1,3-dioxoisoindole-5-carboxylate (PubChem CID 124580361) has the molecular formula C22H15ClFN3O5S and a molecular weight of 487.90 g/mol. Its IUPAC name is [(2S)-4-chloro-1-(4-fluorophenyl)-1-oxobutan-2-yl] 2-(5-methyl-1,3,4-thiadiazol-2-yl)-1,3-dioxoisoindole-5-carboxylate.
| Compound Name | [(2S)-4-chloro-1-(4-fluorophenyl)-1-oxobutan-2-yl] 2-(5-methyl-1,3,4-thiadiazol-2-yl)-1,3-dioxoisoindole-5-carboxylate |
|---|---|
| PubChem CID | 124580361 |
| Molecular Formula | C22H15ClFN3O5S |
| Molecular Weight | 487.90 g/mol |
| Exact Mass | 487.04 |
| IUPAC Name | [(2S)-4-chloro-1-(4-fluorophenyl)-1-oxobutan-2-yl] 2-(5-methyl-1,3,4-thiadiazol-2-yl)-1,3-dioxoisoindole-5-carboxylate |
| SMILES | Cc1nnc(N2C(=O)c3ccc(C(=O)O[C@@H](CCCl)C(=O)c4ccc(F)cc4)cc3C2=O)s1 |
| InChI | InChI=1S/C22H15ClFN3O5S/c1-11-25-26-22(33-11)27-19(29)15-7-4-13(10-16(15)20(27)30)21(31)32-17(8-9-23)18(28)12-2-5-14(24)6-3-12/h2-7,10,17H,8-9H2,1H3/t17-/m0/s1 |
| InChIKey | HZPIRKUHRKSRJG-KRWDZBQOSA-N |
| XLogP | 3.82 |
| TPSA | 106.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.90 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|