C31H27ClFNO5 — CID 98319636
[(2S)-4-chloro-1-(4-fluorophenyl)-1-oxobutan-2-yl] 4-[(3aR,5S,7aS)-1,3-dioxo-5-phenyl-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]benzoate (PubChem CID 98319636) has the molecular formula C31H27ClFNO5 and a molecular weight of 548.01 g/mol. Its IUPAC name is [(2S)-4-chloro-1-(4-fluorophenyl)-1-oxobutan-2-yl] 4-[(3aR,5S,7aS)-1,3-dioxo-5-phenyl-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]benzoate.
| Compound Name | [(2S)-4-chloro-1-(4-fluorophenyl)-1-oxobutan-2-yl] 4-[(3aR,5S,7aS)-1,3-dioxo-5-phenyl-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]benzoate |
|---|---|
| PubChem CID | 98319636 |
| Molecular Formula | C31H27ClFNO5 |
| Molecular Weight | 548.01 g/mol |
| Exact Mass | 547.16 |
| IUPAC Name | [(2S)-4-chloro-1-(4-fluorophenyl)-1-oxobutan-2-yl] 4-[(3aR,5S,7aS)-1,3-dioxo-5-phenyl-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]benzoate |
| SMILES | O=C(O[C@@H](CCCl)C(=O)c1ccc(F)cc1)c1ccc(N2C(=O)[C@H]3CC[C@H](c4ccccc4)C[C@H]3C2=O)cc1 |
| InChI | InChI=1S/C31H27ClFNO5/c32-17-16-27(28(35)20-6-11-23(33)12-7-20)39-31(38)21-8-13-24(14-9-21)34-29(36)25-15-10-22(18-26(25)30(34)37)19-4-2-1-3-5-19/h1-9,11-14,22,25-27H,10,15-18H2/t22-,25-,26+,27-/m0/s1 |
| InChIKey | QPLKZPTUMFSLFP-IXDWGBGWSA-N |
| XLogP | 5.94 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.01 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|