C37H33NO6 — CID 124714879
[(2S)-1-oxo-1-(4-phenylmethoxyphenyl)propan-2-yl] 4-[(3aR,5S,7aR)-1,3-dioxo-5-phenyl-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]benzoate (PubChem CID 124714879) has the molecular formula C37H33NO6 and a molecular weight of 587.67 g/mol. Its IUPAC name is [(2S)-1-oxo-1-(4-phenylmethoxyphenyl)propan-2-yl] 4-[(3aR,5S,7aR)-1,3-dioxo-5-phenyl-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]benzoate.
| Compound Name | [(2S)-1-oxo-1-(4-phenylmethoxyphenyl)propan-2-yl] 4-[(3aR,5S,7aR)-1,3-dioxo-5-phenyl-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]benzoate |
|---|---|
| PubChem CID | 124714879 |
| Molecular Formula | C37H33NO6 |
| Molecular Weight | 587.67 g/mol |
| Exact Mass | 587.23 |
| IUPAC Name | [(2S)-1-oxo-1-(4-phenylmethoxyphenyl)propan-2-yl] 4-[(3aR,5S,7aR)-1,3-dioxo-5-phenyl-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]benzoate |
| SMILES | C[C@H](OC(=O)c1ccc(N2C(=O)[C@@H]3CC[C@H](c4ccccc4)C[C@H]3C2=O)cc1)C(=O)c1ccc(OCc2ccccc2)cc1 |
| InChI | InChI=1S/C37H33NO6/c1-24(34(39)27-14-19-31(20-15-27)43-23-25-8-4-2-5-9-25)44-37(42)28-12-17-30(18-13-28)38-35(40)32-21-16-29(22-33(32)36(38)41)26-10-6-3-7-11-26/h2-15,17-20,24,29,32-33H,16,21-23H2,1H3/t24-,29-,32+,33+/m0/s1 |
| InChIKey | NGDMYVRZSXUPKI-OHZZBQFHSA-N |
| XLogP | 6.77 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.67 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|