C35H22BrCl2FN2O5 — CID 4233025
[4-chloro-1-(4-fluorophenyl)-1-oxobutan-2-yl] 6-bromo-7-chloro-2-[4-(1,3-dioxoisoindol-2-yl)phenyl]-8-methylquinoline-4-carboxylate (PubChem CID 4233025) has the molecular formula C35H22BrCl2FN2O5 and a molecular weight of 720.38 g/mol. Its IUPAC name is [4-chloro-1-(4-fluorophenyl)-1-oxobutan-2-yl] 6-bromo-7-chloro-2-[4-(1,3-dioxoisoindol-2-yl)phenyl]-8-methylquinoline-4-carboxylate.
| Compound Name | [4-chloro-1-(4-fluorophenyl)-1-oxobutan-2-yl] 6-bromo-7-chloro-2-[4-(1,3-dioxoisoindol-2-yl)phenyl]-8-methylquinoline-4-carboxylate |
|---|---|
| PubChem CID | 4233025 |
| Molecular Formula | C35H22BrCl2FN2O5 |
| Molecular Weight | 720.38 g/mol |
| Exact Mass | 718.01 |
| IUPAC Name | [4-chloro-1-(4-fluorophenyl)-1-oxobutan-2-yl] 6-bromo-7-chloro-2-[4-(1,3-dioxoisoindol-2-yl)phenyl]-8-methylquinoline-4-carboxylate |
| SMILES | Cc1c(Cl)c(Br)cc2c(C(=O)OC(CCCl)C(=O)c3ccc(F)cc3)cc(-c3ccc(N4C(=O)c5ccccc5C4=O)cc3)nc12 |
| InChI | InChI=1S/C35H22BrCl2FN2O5/c1-18-30(38)27(36)16-25-26(35(45)46-29(14-15-37)32(42)20-6-10-21(39)11-7-20)17-28(40-31(18)25)19-8-12-22(13-9-19)41-33(43)23-4-2-3-5-24(23)34(41)44/h2-13,16-17,29H,14-15H2,1H3 |
| InChIKey | YHEXZRWLLXIOGF-UHFFFAOYSA-N |
| XLogP | 8.60 |
| TPSA | 93.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 720.38 |
| LogP ≤ 5 | 8.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|