C50H45O2P — CID 173280384
acetic acid;tris(1,1'-biphenyl);(2-phenylphenyl)phosphane (PubChem CID 173280384) has the molecular formula C50H45O2P and a molecular weight of 708.88 g/mol. Its IUPAC name is acetic acid;tris(1,1'-biphenyl);(2-phenylphenyl)phosphane.
| Compound Name | acetic acid;tris(1,1'-biphenyl);(2-phenylphenyl)phosphane |
|---|---|
| PubChem CID | 173280384 |
| Molecular Formula | C50H45O2P |
| Molecular Weight | 708.88 g/mol |
| Exact Mass | 708.32 |
| IUPAC Name | acetic acid;tris(1,1'-biphenyl);(2-phenylphenyl)phosphane |
| SMILES | CC(=O)O.Pc1ccccc1-c1ccccc1.c1ccc(-c2ccccc2)cc1.c1ccc(-c2ccccc2)cc1.c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C12H11P.3C12H10.C2H4O2/c13-12-9-5-4-8-11(12)10-6-2-1-3-7-10;3*1-3-7-11(8-4-1)12-9-5-2-6-10-12;1-2(3)4/h1-9H,13H2;3*1-10H;1H3,(H,3,4) |
| InChIKey | REZAKODXOMGYDV-UHFFFAOYSA-N |
| XLogP | 13.01 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 708.88 |
| LogP ≤ 5 | 13.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|