About CID 6368400
CID 6368400 (PubChem CID 6368400) has the molecular formula C19H16GeO2-
and a molecular weight of 348.95 g/mol.
Molecular Properties
| Compound Name | CID 6368400 |
| PubChem CID | 6368400 |
| Molecular Formula | C19H16GeO2- |
| Molecular Weight | 348.95 g/mol |
| Exact Mass | 350.04 |
| IUPAC Name | — |
| SMILES | O=C[O-].c1ccc([Ge](c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C18H15Ge.CH2O2/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;2-1-3/h1-15H;1H,(H,2,3)/p-1 |
| InChIKey | SBQIZIQPNALQFX-UHFFFAOYSA-M |
| XLogP | 0.57 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 348.95 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze CID 6368400 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 6368400?
The IUPAC name of CID 6368400 (CID 6368400) is not available.
What is the SMILES notation for CID 6368400?
The canonical SMILES for CID 6368400 is O=C[O-].c1ccc([Ge](c2ccccc2)c2ccccc2)cc1.
What is the InChIKey of CID 6368400?
The InChIKey is SBQIZIQPNALQFX-UHFFFAOYSA-M. The full InChI is InChI=1S/C18H15Ge.CH2O2/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;2-1-3/h1-15H;1H,(H,2,3)/p-1.
What are the key properties of CID 6368400?
CID 6368400 has a molecular weight of 348.95 g/mol, XLogP of 0.57, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 6368400 is sourced from PubChem (CID 6368400), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).