C10H12FNO3S — CID 79512385
2-(2-amino-5-ethoxyphenyl)sulfanyl-2-fluoroacetic acid (PubChem CID 79512385) has the molecular formula C10H12FNO3S and a molecular weight of 245.27 g/mol. Its IUPAC name is 2-(2-amino-5-ethoxyphenyl)sulfanyl-2-fluoroacetic acid.
| Compound Name | 2-(2-amino-5-ethoxyphenyl)sulfanyl-2-fluoroacetic acid |
|---|---|
| PubChem CID | 79512385 |
| Molecular Formula | C10H12FNO3S |
| Molecular Weight | 245.27 g/mol |
| Exact Mass | 245.05 |
| IUPAC Name | 2-(2-amino-5-ethoxyphenyl)sulfanyl-2-fluoroacetic acid |
| SMILES | CCOc1ccc(N)c(SC(F)C(=O)O)c1 |
| InChI | InChI=1S/C10H12FNO3S/c1-2-15-6-3-4-7(12)8(5-6)16-9(11)10(13)14/h3-5,9H,2,12H2,1H3,(H,13,14) |
| InChIKey | DIURJYPLMAMNLP-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.27 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|