C18H27NO2 — CID 65257858
5-(2-tert-butyl-4-methoxyphenoxy)-2,2-dimethylpentanenitrile (PubChem CID 65257858) has the molecular formula C18H27NO2 and a molecular weight of 289.42 g/mol. Its IUPAC name is 5-(2-tert-butyl-4-methoxyphenoxy)-2,2-dimethylpentanenitrile.
| Compound Name | 5-(2-tert-butyl-4-methoxyphenoxy)-2,2-dimethylpentanenitrile |
|---|---|
| PubChem CID | 65257858 |
| Molecular Formula | C18H27NO2 |
| Molecular Weight | 289.42 g/mol |
| Exact Mass | 289.20 |
| IUPAC Name | 5-(2-tert-butyl-4-methoxyphenoxy)-2,2-dimethylpentanenitrile |
| SMILES | COc1ccc(OCCCC(C)(C)C#N)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C18H27NO2/c1-17(2,3)15-12-14(20-6)8-9-16(15)21-11-7-10-18(4,5)13-19/h8-9,12H,7,10-11H2,1-6H3 |
| InChIKey | DJXRJZGASZBVRU-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 42.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.42 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|