C16H23NO2 — CID 103866440
5-(4-ethyl-2-methoxyphenoxy)-2,2-dimethylpentanenitrile (PubChem CID 103866440) has the molecular formula C16H23NO2 and a molecular weight of 261.37 g/mol. Its IUPAC name is 5-(4-ethyl-2-methoxyphenoxy)-2,2-dimethylpentanenitrile.
| Compound Name | 5-(4-ethyl-2-methoxyphenoxy)-2,2-dimethylpentanenitrile |
|---|---|
| PubChem CID | 103866440 |
| Molecular Formula | C16H23NO2 |
| Molecular Weight | 261.37 g/mol |
| Exact Mass | 261.17 |
| IUPAC Name | 5-(4-ethyl-2-methoxyphenoxy)-2,2-dimethylpentanenitrile |
| SMILES | CCc1ccc(OCCCC(C)(C)C#N)c(OC)c1 |
| InChI | InChI=1S/C16H23NO2/c1-5-13-7-8-14(15(11-13)18-4)19-10-6-9-16(2,3)12-17/h7-8,11H,5-6,9-10H2,1-4H3 |
| InChIKey | PHEHDKDMJKHMMT-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 42.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.37 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|