C9H14N2S — CID 3017084
4-propylsulfanylbenzene-1,2-diamine (PubChem CID 3017084) has the molecular formula C9H14N2S and a molecular weight of 182.29 g/mol. Its IUPAC name is 4-propylsulfanylbenzene-1,2-diamine.
| Compound Name | 4-propylsulfanylbenzene-1,2-diamine |
|---|---|
| PubChem CID | 3017084 |
| Molecular Formula | C9H14N2S |
| Molecular Weight | 182.29 g/mol |
| Exact Mass | 182.09 |
| IUPAC Name | 4-propylsulfanylbenzene-1,2-diamine |
| SMILES | CCCSc1ccc(N)c(N)c1 |
| InChI | InChI=1S/C9H14N2S/c1-2-5-12-7-3-4-8(10)9(11)6-7/h3-4,6H,2,5,10-11H2,1H3 |
| InChIKey | YXXYBJDTATZCOJ-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.29 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|