About N-[2-(3,4-dimethylphenyl)sulfanylethylideneamino]-N-methylaniline
N-[2-(3,4-dimethylphenyl)sulfanylethylideneamino]-N-methylaniline (PubChem CID 139637692) has the molecular formula C17H20N2S
and a molecular weight of 284.43 g/mol. Its IUPAC name is N-[2-(3,4-dimethylphenyl)sulfanylethylideneamino]-N-methylaniline.
Molecular Properties
| Compound Name | N-[2-(3,4-dimethylphenyl)sulfanylethylideneamino]-N-methylaniline |
| PubChem CID | 139637692 |
| Molecular Formula | C17H20N2S |
| Molecular Weight | 284.43 g/mol |
| Exact Mass | 284.13 |
| IUPAC Name | N-[2-(3,4-dimethylphenyl)sulfanylethylideneamino]-N-methylaniline |
| SMILES | Cc1ccc(SCC=NN(C)c2ccccc2)cc1C |
| InChI | InChI=1S/C17H20N2S/c1-14-9-10-17(13-15(14)2)20-12-11-18-19(3)16-7-5-4-6-8-16/h4-11,13H,12H2,1-3H3 |
| InChIKey | BWAHVXYXCPYDHA-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.43 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-[2-(3,4-dimethylphenyl)sulfanylethylideneamino]-N-methylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-(3,4-dimethylphenyl)sulfanylethylideneamino]-N-methylaniline?
The IUPAC name of N-[2-(3,4-dimethylphenyl)sulfanylethylideneamino]-N-methylaniline (CID 139637692) is N-[2-(3,4-dimethylphenyl)sulfanylethylideneamino]-N-methylaniline.
What is the SMILES notation for N-[2-(3,4-dimethylphenyl)sulfanylethylideneamino]-N-methylaniline?
The canonical SMILES for N-[2-(3,4-dimethylphenyl)sulfanylethylideneamino]-N-methylaniline is Cc1ccc(SCC=NN(C)c2ccccc2)cc1C.
What is the InChIKey of N-[2-(3,4-dimethylphenyl)sulfanylethylideneamino]-N-methylaniline?
The InChIKey is BWAHVXYXCPYDHA-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H20N2S/c1-14-9-10-17(13-15(14)2)20-12-11-18-19(3)16-7-5-4-6-8-16/h4-11,13H,12H2,1-3H3.
What are the key properties of N-[2-(3,4-dimethylphenyl)sulfanylethylideneamino]-N-methylaniline?
N-[2-(3,4-dimethylphenyl)sulfanylethylideneamino]-N-methylaniline has a molecular weight of 284.43 g/mol, XLogP of 4.52, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-(3,4-dimethylphenyl)sulfanylethylideneamino]-N-methylaniline is sourced from PubChem (CID 139637692), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).