C12H14S — CID 131154465
4-but-2-ynylsulfanyl-1,2-dimethylbenzene (PubChem CID 131154465) has the molecular formula C12H14S and a molecular weight of 190.31 g/mol. Its IUPAC name is 4-but-2-ynylsulfanyl-1,2-dimethylbenzene.
| Compound Name | 4-but-2-ynylsulfanyl-1,2-dimethylbenzene |
|---|---|
| PubChem CID | 131154465 |
| Molecular Formula | C12H14S |
| Molecular Weight | 190.31 g/mol |
| Exact Mass | 190.08 |
| IUPAC Name | 4-but-2-ynylsulfanyl-1,2-dimethylbenzene |
| SMILES | CC#CCSc1ccc(C)c(C)c1 |
| InChI | InChI=1S/C12H14S/c1-4-5-8-13-12-7-6-10(2)11(3)9-12/h6-7,9H,8H2,1-3H3 |
| InChIKey | SEOVROXBNNSRET-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.31 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|