About 4-but-2-ynylsulfanyl-1,2-dimethylbenzene
4-but-2-ynylsulfanyl-1,2-dimethylbenzene (PubChem CID 131154465) has the molecular formula C12H14S
and a molecular weight of 190.31 g/mol. Its IUPAC name is 4-but-2-ynylsulfanyl-1,2-dimethylbenzene.
Molecular Properties
| Compound Name | 4-but-2-ynylsulfanyl-1,2-dimethylbenzene |
| PubChem CID | 131154465 |
| Molecular Formula | C12H14S |
| Molecular Weight | 190.31 g/mol |
| Exact Mass | 190.08 |
| IUPAC Name | 4-but-2-ynylsulfanyl-1,2-dimethylbenzene |
| SMILES | CC#CCSc1ccc(C)c(C)c1 |
| InChI | InChI=1S/C12H14S/c1-4-5-8-13-12-7-6-10(2)11(3)9-12/h6-7,9H,8H2,1-3H3 |
| InChIKey | SEOVROXBNNSRET-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.31 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-but-2-ynylsulfanyl-1,2-dimethylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-but-2-ynylsulfanyl-1,2-dimethylbenzene?
The IUPAC name of 4-but-2-ynylsulfanyl-1,2-dimethylbenzene (CID 131154465) is 4-but-2-ynylsulfanyl-1,2-dimethylbenzene.
What is the SMILES notation for 4-but-2-ynylsulfanyl-1,2-dimethylbenzene?
The canonical SMILES for 4-but-2-ynylsulfanyl-1,2-dimethylbenzene is CC#CCSc1ccc(C)c(C)c1.
What is the InChIKey of 4-but-2-ynylsulfanyl-1,2-dimethylbenzene?
The InChIKey is SEOVROXBNNSRET-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14S/c1-4-5-8-13-12-7-6-10(2)11(3)9-12/h6-7,9H,8H2,1-3H3.
What are the key properties of 4-but-2-ynylsulfanyl-1,2-dimethylbenzene?
4-but-2-ynylsulfanyl-1,2-dimethylbenzene has a molecular weight of 190.31 g/mol, XLogP of 3.42, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-but-2-ynylsulfanyl-1,2-dimethylbenzene is sourced from PubChem (CID 131154465), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).