C8H9ClS — CID 117036068
(3,4-dimethylphenyl) thiohypochlorite (PubChem CID 117036068) has the molecular formula C8H9ClS and a molecular weight of 172.68 g/mol. Its IUPAC name is (3,4-dimethylphenyl) thiohypochlorite.
| Compound Name | (3,4-dimethylphenyl) thiohypochlorite |
|---|---|
| PubChem CID | 117036068 |
| Molecular Formula | C8H9ClS |
| Molecular Weight | 172.68 g/mol |
| Exact Mass | 172.01 |
| IUPAC Name | (3,4-dimethylphenyl) thiohypochlorite |
| SMILES | Cc1ccc(SCl)cc1C |
| InChI | InChI=1S/C8H9ClS/c1-6-3-4-8(10-9)5-7(6)2/h3-5H,1-2H3 |
| InChIKey | OBPBQUUMILMISD-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.68 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |