C16H19NS — CID 55079206
2-[2-(3,4-dimethylphenyl)sulfanylethyl]aniline (PubChem CID 55079206) has the molecular formula C16H19NS and a molecular weight of 257.40 g/mol. Its IUPAC name is 2-[2-(3,4-dimethylphenyl)sulfanylethyl]aniline.
| Compound Name | 2-[2-(3,4-dimethylphenyl)sulfanylethyl]aniline |
|---|---|
| PubChem CID | 55079206 |
| Molecular Formula | C16H19NS |
| Molecular Weight | 257.40 g/mol |
| Exact Mass | 257.12 |
| IUPAC Name | 2-[2-(3,4-dimethylphenyl)sulfanylethyl]aniline |
| SMILES | Cc1ccc(SCCc2ccccc2N)cc1C |
| InChI | InChI=1S/C16H19NS/c1-12-7-8-15(11-13(12)2)18-10-9-14-5-3-4-6-16(14)17/h3-8,11H,9-10,17H2,1-2H3 |
| InChIKey | RCLRQELKKPHYBQ-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.40 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|