C15H19BrClNO5 — CID 8942559
[(2S)-1-(2-methoxyethylamino)-1-oxopropan-2-yl] 2-(4-bromo-2-chloro-6-methylphenoxy)acetate (PubChem CID 8942559) has the molecular formula C15H19BrClNO5 and a molecular weight of 408.68 g/mol. Its IUPAC name is [(2S)-1-(2-methoxyethylamino)-1-oxopropan-2-yl] 2-(4-bromo-2-chloro-6-methylphenoxy)acetate.
| Compound Name | [(2S)-1-(2-methoxyethylamino)-1-oxopropan-2-yl] 2-(4-bromo-2-chloro-6-methylphenoxy)acetate |
|---|---|
| PubChem CID | 8942559 |
| Molecular Formula | C15H19BrClNO5 |
| Molecular Weight | 408.68 g/mol |
| Exact Mass | 407.01 |
| IUPAC Name | [(2S)-1-(2-methoxyethylamino)-1-oxopropan-2-yl] 2-(4-bromo-2-chloro-6-methylphenoxy)acetate |
| SMILES | COCCNC(=O)[C@H](C)OC(=O)COc1c(C)cc(Br)cc1Cl |
| InChI | InChI=1S/C15H19BrClNO5/c1-9-6-11(16)7-12(17)14(9)22-8-13(19)23-10(2)15(20)18-4-5-21-3/h6-7,10H,4-5,8H2,1-3H3,(H,18,20)/t10-/m0/s1 |
| InChIKey | UOAQNVIZDYAISD-JTQLQIEISA-N |
| XLogP | 2.48 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.68 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|