C20H23ClN2O4 — CID 134006769
methyl 3-(2-chlorophenyl)-3-[[2-(methoxymethyl)phenyl]methylcarbamoylamino]propanoate (PubChem CID 134006769) has the molecular formula C20H23ClN2O4 and a molecular weight of 390.87 g/mol. Its IUPAC name is methyl 3-(2-chlorophenyl)-3-[[2-(methoxymethyl)phenyl]methylcarbamoylamino]propanoate.
| Compound Name | methyl 3-(2-chlorophenyl)-3-[[2-(methoxymethyl)phenyl]methylcarbamoylamino]propanoate |
|---|---|
| PubChem CID | 134006769 |
| Molecular Formula | C20H23ClN2O4 |
| Molecular Weight | 390.87 g/mol |
| Exact Mass | 390.13 |
| IUPAC Name | methyl 3-(2-chlorophenyl)-3-[[2-(methoxymethyl)phenyl]methylcarbamoylamino]propanoate |
| SMILES | COCc1ccccc1CNC(=O)NC(CC(=O)OC)c1ccccc1Cl |
| InChI | InChI=1S/C20H23ClN2O4/c1-26-13-15-8-4-3-7-14(15)12-22-20(25)23-18(11-19(24)27-2)16-9-5-6-10-17(16)21/h3-10,18H,11-13H2,1-2H3,(H2,22,23,25) |
| InChIKey | QZQRXKCIXHQZOM-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.87 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |