C13H14ClNO5S — CID 63307159
(2S)-2-[[2-(4-chlorophenyl)sulfanylacetyl]amino]-4-methoxy-4-oxobutanoic acid (PubChem CID 63307159) has the molecular formula C13H14ClNO5S and a molecular weight of 331.78 g/mol. Its IUPAC name is (2S)-2-[[2-(4-chlorophenyl)sulfanylacetyl]amino]-4-methoxy-4-oxobutanoic acid.
| Compound Name | (2S)-2-[[2-(4-chlorophenyl)sulfanylacetyl]amino]-4-methoxy-4-oxobutanoic acid |
|---|---|
| PubChem CID | 63307159 |
| Molecular Formula | C13H14ClNO5S |
| Molecular Weight | 331.78 g/mol |
| Exact Mass | 331.03 |
| IUPAC Name | (2S)-2-[[2-(4-chlorophenyl)sulfanylacetyl]amino]-4-methoxy-4-oxobutanoic acid |
| SMILES | COC(=O)C[C@H](NC(=O)CSc1ccc(Cl)cc1)C(=O)O |
| InChI | InChI=1S/C13H14ClNO5S/c1-20-12(17)6-10(13(18)19)15-11(16)7-21-9-4-2-8(14)3-5-9/h2-5,10H,6-7H2,1H3,(H,15,16)(H,18,19)/t10-/m0/s1 |
| InChIKey | WYSZWKBUXJCMTK-JTQLQIEISA-N |
| XLogP | 1.56 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.78 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |