C28H23N3O3S2 — CID 4280238
4-[ethyl(phenyl)sulfamoyl]-N-(4-naphthalen-1-yl-1,3-thiazol-2-yl)benzamide (PubChem CID 4280238) has the molecular formula C28H23N3O3S2 and a molecular weight of 513.64 g/mol. Its IUPAC name is 4-[ethyl(phenyl)sulfamoyl]-N-(4-naphthalen-1-yl-1,3-thiazol-2-yl)benzamide.
| Compound Name | 4-[ethyl(phenyl)sulfamoyl]-N-(4-naphthalen-1-yl-1,3-thiazol-2-yl)benzamide |
|---|---|
| PubChem CID | 4280238 |
| Molecular Formula | C28H23N3O3S2 |
| Molecular Weight | 513.64 g/mol |
| Exact Mass | 513.12 |
| IUPAC Name | 4-[ethyl(phenyl)sulfamoyl]-N-(4-naphthalen-1-yl-1,3-thiazol-2-yl)benzamide |
| SMILES | CCN(c1ccccc1)S(=O)(=O)c1ccc(C(=O)Nc2nc(-c3cccc4ccccc34)cs2)cc1 |
| InChI | InChI=1S/C28H23N3O3S2/c1-2-31(22-11-4-3-5-12-22)36(33,34)23-17-15-21(16-18-23)27(32)30-28-29-26(19-35-28)25-14-8-10-20-9-6-7-13-24(20)25/h3-19H,2H2,1H3,(H,29,30,32) |
| InChIKey | XSNCRYRLRYJXCR-UHFFFAOYSA-N |
| XLogP | 6.43 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.64 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |