C25H21N3O4S2 — CID 4050137
N-(4H-chromeno[4,3-d][1,3]thiazol-2-yl)-4-[ethyl(phenyl)sulfamoyl]benzamide (PubChem CID 4050137) has the molecular formula C25H21N3O4S2 and a molecular weight of 491.59 g/mol. Its IUPAC name is N-(4H-chromeno[4,3-d][1,3]thiazol-2-yl)-4-[ethyl(phenyl)sulfamoyl]benzamide.
| Compound Name | N-(4H-chromeno[4,3-d][1,3]thiazol-2-yl)-4-[ethyl(phenyl)sulfamoyl]benzamide |
|---|---|
| PubChem CID | 4050137 |
| Molecular Formula | C25H21N3O4S2 |
| Molecular Weight | 491.59 g/mol |
| Exact Mass | 491.10 |
| IUPAC Name | N-(4H-chromeno[4,3-d][1,3]thiazol-2-yl)-4-[ethyl(phenyl)sulfamoyl]benzamide |
| SMILES | CCN(c1ccccc1)S(=O)(=O)c1ccc(C(=O)Nc2nc3c(s2)COc2ccccc2-3)cc1 |
| InChI | InChI=1S/C25H21N3O4S2/c1-2-28(18-8-4-3-5-9-18)34(30,31)19-14-12-17(13-15-19)24(29)27-25-26-23-20-10-6-7-11-21(20)32-16-22(23)33-25/h3-15H,2,16H2,1H3,(H,26,27,29) |
| InChIKey | APAVIUFCGQIHTP-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 88.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.59 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |