C23H16N2O2S — CID 4583151
N-(4H-chromeno[4,3-d][1,3]thiazol-2-yl)-4-phenylbenzamide (PubChem CID 4583151) has the molecular formula C23H16N2O2S and a molecular weight of 384.46 g/mol. Its IUPAC name is N-(4H-chromeno[4,3-d][1,3]thiazol-2-yl)-4-phenylbenzamide.
| Compound Name | N-(4H-chromeno[4,3-d][1,3]thiazol-2-yl)-4-phenylbenzamide |
|---|---|
| PubChem CID | 4583151 |
| Molecular Formula | C23H16N2O2S |
| Molecular Weight | 384.46 g/mol |
| Exact Mass | 384.09 |
| IUPAC Name | N-(4H-chromeno[4,3-d][1,3]thiazol-2-yl)-4-phenylbenzamide |
| SMILES | O=C(Nc1nc2c(s1)COc1ccccc1-2)c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C23H16N2O2S/c26-22(17-12-10-16(11-13-17)15-6-2-1-3-7-15)25-23-24-21-18-8-4-5-9-19(18)27-14-20(21)28-23/h1-13H,14H2,(H,24,25,26) |
| InChIKey | DQFPEJRWEGWTKX-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.46 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |